1-Oleoyl Lysophosphatidic Acid - CAS 65528-98-5

1-Oleoyl Lysophosphatidic Acid (1-Oleoyl LPA) is a biologically active phospholipid that can exert multiple biological effects in various disease states of the kidney by activating a complex network of at least six homologous G protein-coupled receptors and their heterotrimeric G proteins. 1-Oleoyl Lysophosphatidic Acid promotes polarization of BV-2 and primary murine microglia toward an M1-like phenotype and can be used to study cancer and atherosclerosis.

LPL Receptor

GPCR/G Protein

65425

C21H41O7P

436.52

O(C(CCCCCCC/C=C\CCCCCCCC)=O)C[C@H](COP(=O)(O)O)O

-20°C

Ice Packs

Small Compound