2,2,6,6-Tetramethylpiperidine-N-oxyl-4-amino-4-carboxylic acid - CAS 15871-57-5

2,2,6,6-Tetramethylpiperidine-N-oxyl-4-amino-4-carboxylic acid (TOAC) is a compound that can probe conformational changes, folding processes, and interactions of peptides and proteins. It is commonly utilized in biological research to gain insights into the behavior and function of biological macromolecules. TOAC plays a significant role in analyzing the interactions and dynamic responses of biological systems.

15871-57-5

C10H19N2O3

215.27

[O]N1C(C)(C)CC(C(O)=O)(N)CC1(C)C

-20°C

Ice Packs

Inhibitors & Agonists