2,3-dinor-8-iso Prostaglandin F2α - CAS 221664-05-7

8-isoProstaglandin F2α (8-isoPGF2α; 8-isoprostane) is a byproduct of non-specific lipid peroxidation, resembling prostaglandin in structure. In humans and rats, its metabolite, 12,3-dinor-8-isoPGF2α, is formed following exogenous administration of 8-isoPGF2α, which is converted to 2,3-dinor-8-isoPGF1α and 2,3-dinor-8-isoPGF2α. Additionally, rat hepatocytes can further break down 8-isoPGF2α into a β-oxidation product, 2,3,4,5-tetranor-8-isoPGF2α. The metabolite, 2,3-dinor-8-isoPGF2α, is normally found in human urine at concentrations of 200-300 pg/ml. Its levels rise in conditions associated with oxidative stress, such as smoking, demonstrating a correlation with the concentration of its precursor, 8-isoPGF2α.

Others, Drug Metabolite

Metabolism, Others

221664-05-7

C18H30O5

326.4

C(/C=C\CC(O)=O)[C@H]1[C@@H](/C=C/[C@H](CCCCC)O)[C@H](O)C[C@@H]1O

-20°C

Ice Packs

Small Compound