3-AP-Me - CAS 1184391-57-8

3-AP-Me is the dimethyl derivative of the ribonucleotide reductase inhibitor 3-AP (SML0568) . It activates the endoplasmic reticulum (ER) stress pathway by promoting eIF2α phosphorylation and upregulating gene expression of transcription factors ATF4 and ATF6, thereby inducing apoptosis. Additionally, 3-AP-Me activates cellular stress kinases c-Jun N-terminal kinase (JNK) and p38 mitogen-activated protein kinase, leading to the upregulation of spliced mRNA variant XBP1. It is applicable in cancer research.

PERK, Apoptosis, p38 MAPK, JNK

MAPK, Apoptosis

1184326

C9H13N5S

223.298

S=C(NN=CC1=NC=CC=C1N)N(C)C

-20°C

Ice Packs

Small Compound