(3S,4R) -ME-344 - CAS 1374524-84-1

(3S,4R) -ME-344 is the (3S,4R) -enantiomer of ME-344. As an inhibitor of mitochondrial heme oxygenase 1 (HO-1), ME-344 specifically binds to and alters the structure of HO-1, facilitating its translocation from the rough endoplasmic reticulum to mitochondria, but only in drug-sensitive cells like H460 and SHP-77. This compound reduces mitochondrial ATP production and induces reactive oxygen species (ROS), disrupting redox balance and mitochondrial function. ME-344 exhibits significant antitumor activity, making it useful in cancer research, such as for breast cancer.

Mitochondrial Metabolism, ROS

Metabolism, Immunology/Inflammation

1374524-84-1

C22H20O4

348.39

CC1=C2C([C@H]([C@H](CO2)C3=CC=C(O)C=C3)C4=CC=C(O)C=C4)=CC=C1O

-20°C

Ice Packs

Inhibitors & Agonists