4- (Azidomethyl) benzoic acid - CAS 79584-03-5

4- (Azidomethyl) benzoic acid is a click chemistry reagent that contains an azido group. Click chemistry holds substantial potential for linking nucleic acids, lipids, proteins, and other molecules due to its beneficial attributes such as high yield, specificity, and simplicity, making it widely applicable across various research fields.

ADC Linker

Antibody-drug Conjugate/ADC Related

79584-03-05

C8H7N3O2

177.16

[N-]=[N+]=NCC1=CC=C(C=C1)C(=O)O

-20°C

Ice Packs

Small Compound