5,10,15,20-Tetrakis (p-tolyl) porphyrin - CAS 14527-51-6

5,10,15,20-Tetrakis (p-tolyl) porphyrin (TTP) is an organic compound classified within the porphyrin family, characterized by a cyclic structure formed from four pyrrole rings. TTP is a synthetic porphyrin commonly employed as a sensitizer in dye-sensitized solar cells and as a catalyst in various organic reactions. Owing to its unique structure, TTP exhibits a range of intriguing properties, including specific wavelength absorption and potential as a catalyst for different chemical reactions. In dye-sensitized solar cells, TTP aids in converting sunlight into electrical energy by absorbing photons and transferring electrons to the device's semiconductor layer. In organic chemistry, TTP is frequently utilized as a catalyst for reactions such as oxidation and reduction, selectively binding to certain substrates, making it a valuable tool for synthesizing complex molecules and studying their properties.

14527-51-6

C48H38N4

670.8421

CC1=CC=C(/C2=C3C=CC(/C(C4=CC=C(C)C=C4)=C(N/5)/C=CC5=C(C6=CC=C(C)C=C6)\C7=N/C(C=C7)=C(C8=CC=C(C)C=C8)\C9=CC=C2N9)=N\3)C=C1

-20°C

Ice Packs

Inhibitors & Agonists