8-Gingerol - CAS 23513-08-8

1. 8-Gingerol has antioxidant activity. 2. 8-Gingerol has antimycobacterial activity. 3. 8-Gingerol could be used as an effective skin-whitening agent. 4. 8-Gingerol shows antipyretic and anti-inflammation characteristics. 5. 8-Gingerol seems to be effective in an animal model of rheumatoid arthritis. 6. 8-Gingerol inhibits the anti-serotonin 3 receptor function, exhibits cardiotonic activity. 7. 8-Gingerol affects gastric motility and potentially have an antispasmodic effect on the gastrointestinal system. 8. 8-gingerol inhibited melanogenesis in B16F1 and B16F1 cells by down-regulation of both mitogen-activated protein kinases (MAPK) and protein kinase A (PKA) signaling pathways or through its antioxidant properties.

Apoptosis, Caspase, Akt, Antioxidant, MMP, mTOR, Autophagy, EGFR, STAT, PERK, PI3K, Antibacterial, TRP/TRPV Channel

Cytoskeletal Signaling, PI3K/Akt/mTOR signaling, Autophagy, JAK/STAT signaling, Tyrosine Kinase/Adaptors, Angiogenesis, Membrane transporter/Ion channel, Stem Cells, Proteases/Proteasome, Oxidation-Reduction, Apoptosis, Microbiology/Virology

23513-08-8

0.9992

C19H30O4

322.44

CCCCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1

-20°C

Ice Packs

Natural Product