9-keto Fluprostenol isopropyl ester - CAS 1219032-18-4

9-Keto Fluprostenol Isopropyl Ester, an ester derivative of the FP receptor agonist fluprostenol, undergoes oxidation at carbon 9. This compound serves as a potential prodrug for 9-keto fluprostenol, which may function as an agonist at EP receptors. Additionally, it is considered a possible metabolite of fluprostenol isopropyl ester (travoprost), drawing parallels to the metabolism of latanoprost by 15-hydroxyprostaglandin dehydrogenase observed in monkey cornea. Furthermore, certain F-series prostaglandins, such as 6-keto prostaglandin F1α (PGF1α), undergo conversion to their E-series counterparts in isolated human platelets, highlighting a metabolic pathway of relevance.

Others, Prostaglandin Receptor

Immunology/Inflammation, Others, GPCR/G Protein

1219032-18-4

C26H33F3O6

498.5

C(/C=C\CCCC(OC(C)C)=O)[C@@H]1[C@@H](/C=C/[C@H](COC2=CC(C(F)(F)F)=CC=C2)O)[C@H](O)CC1=O

-20°C

Ice Packs

Small Compound