AC-4-130 - CAS 1834571-82-2

AC-4-130, a powerful inhibitor of the SH2 domain of STAT5, effectively hinders STAT5 activation, dimerization, nuclear translocation, and transcription of genes reliant on STAT5. This compound directly binds to STAT5, ultimately leading to cell cycle arrest and apoptosis in FLT3-ITD-driven leukemic cells. AC-4-130 exhibits notable anti-cancer properties and effectively suppresses abnormal STAT5 activity in acute myeloid leukemia (AML), making it a promising therapeutic option [1].

STAT, Apoptosis, Others

JAK/STAT signaling, Others, Apoptosis, Stem Cells

1834487

C37H36ClF5N2O5S

751.2

CC(C)(C)c1cc(CN(C(=O)CN(Cc2ccc(Cl)cc2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c2ccc(cc2)C(O)=O)cc(c1)C(C)(C)C

-20°C

Ice Packs

Small Compound