ACE-083 - CAS 81080-10-6

ACE-083 is a follistatin-based therapeutic agent known for its localized mechanism of action. It works by binding to myostatin and other muscle-regulating factors to enhance muscle mass. ACE-083 has undergone testing in various clinical trials for different neuromuscular diseases, yielding mixed results. Notably, in a Phase 2 clinical trial for FSHD, it increased muscle volume, but did not improve function, leading to the discontinuation of its use for FSHD treatment.

81064

C20H31N3O2

345.48

O=C(NC=1C=C(C(O)=C(C1)CN2CCCCC2)CN3CCCCC3)C

-20°C

Ice Packs

Small Compound