Anti-TNBC agent-1 - CAS 2289585-58-4

Anti-TNBC agent-1 is a highly effective compound specifically targeting and combating triple-negative breast cancer (TNBC), demonstrating remarkable potency against various breast cancer cell types with IC50 values ranging from 0.20 μM to 0.27 μM. Its mechanism of action involves inducing apoptosis in SUM-159 cells through the mitochondria pathway and causing G1 phase arrest in these cells.

Apoptosis, Others

Others, Apoptosis

2289523

C26H30O7

454.51

[H][C@]12O[C@]1(C)CC\C=C(COC(=O)\C=C\c1c(OC)cccc1OC)/CC[C@@]1([H])C(=C)C(=O)O[C@]21[H]

-20°C

Ice Packs

Small Compound