Anticancer agent 235 - CAS 2411108-21-7

Anticanceragent 235 (Compound 49) functions as a modulator of the PI3K/AKT/mTOR signaling pathway, enhancing reactive oxygen species (ROS) production and reducing mitochondrial membrane potential, thereby inhibiting the proliferation of cancer cell lines HCT116, Caco-2, AGS, and SMMC-772 with IC50 values ranging from 0.35 to 26.9 μM. Additionally, it induces apoptosis and causes cell cycle arrest at the G2/M phase in HCT-116 cells.

Reactive Oxygen Species, Akt, Apoptosis, PI3K

PI3K/Akt/mTOR signaling, Metabolism, Cytoskeletal Signaling, Immunology/Inflammation, Apoptosis, NF-κB

2411108-21-7

C17H13ClN2O

296.75

ClC1=CC=C2C(=C1)C=C3C(=NC=4C=C(OC)C=CC43)N2C

-20°C

Ice Packs

Small Compound