Antifungal agent 134 - CAS 3080992-04-4

Antifungalagent 134 (Compound B13) is an antifungal agent effective against Botrytis cinerea, Alternaria solani, Fusarium graminearum, Rhizoctonia solani, Colletotrichum orbiculare, and Alternaria alternata with EC50 values of 3.24, 1.89, 1.70, 0.36, 4.27, and 1.50 μg/mL, respectively. It disrupts the fungal cell membranes and mitochondria, leading to substantial accumulation of reactive oxygen species (ROS) . Additionally, Antifungalagent 134 exhibits significant herbicidal activity on field weeds such as Amaranthus retroflexus L and Abutilon theophrasti Medicus, and is applicable in crop disease and field weed research.

Others, Antifungal, ROS

Others, Microbiology/Virology, Immunology/Inflammation

3080992-04-4

C18H12F4N2O4

396.29

O=C1OC=2C=C(OCC(=O)NNC3=CC=C(F)C=C3)C=CC2C(=C1)C(F)(F)F

-20°C

Ice Packs

Small Compound