Antitumor agent-78 - CAS 9007-83-4

Antitumor agent-78 inhibits GPx-4 and elevates COX2, leading to ferroptosis. antitumor agent-78 activates the tumor cell intrinsic apoptotic pathway (Bax-Bcl-2-caspase-3) and inhibits the epithelial mesenchymal transition (EMT) process in tumor cells. Antitumor agent-78 exhibits antitumor effects and inhibits the growth and migration of cancer cells.

Others, COX, Apoptosis, Bcl-2 Family, Ferroptosis

Immunology/Inflammation, Apoptosis, Neuroscience, Others

8920

[Pt++].[NH-][C@@H]1CCCC[C@H]1[NH-].OC(=O)C1(CC(O)(C1)C(F)(F)F)C(O)=O

-20°C

Ice Packs

Small Compound