Aphidicolin - CAS 38966-21-1

Aphidicolin, an antibiotic derived from the mold Cephalosporium aphidicola, is a potent inhibitor of DNA (deoxyribonucleic acid) synthesis, effectively hindering the proliferation of herpes simplex virus[2]. It targets DNA polymerase α and δ, disrupting mitotic cell division by affecting DNA polymerase activity[1]. Additionally, aphidicolin enhances apoptosis when combined with arabinosyl nucleosides in a human promyelocytic leukemia cell line[3].

DNA/RNA Synthesis, Others, HSV, Apoptosis, Antibiotic, Virus Protease

Microbiology/Virology, Apoptosis, DNA Damage/DNA Repair, Cell Cycle/Checkpoint, Others

38944

>99.99%

C20H34O4

338.48

[H][C@]12C[C@]3([H])C[C@]1(CC[C@]3(O)CO)[C@@]1(C)CC[C@@H](O)[C@@](C)(CO)[C@]1([H])CC2

-20°C

Ice Packs

Natural Product