Benzyltributylammonium chloride - CAS 23616-79-7

Benzyltributylammonium chloride is an organic salt compound commonly utilized as a catalyst and surfactant. It serves as a catalyst in specific organic synthesis reactions and can be used as a cleaning agent, lubricant, and emulsifier. Additionally, this compound finds extensive use in various industrial sectors, such as in the manufacturing processes of plastics, rubber, and textiles.

23616-79-7

C19H34ClN

311.93

[Cl-].C=1C=CC(=CC1)C[N+](CCCC)(CCCC)CCCC

-20°C

Ice Packs

Inhibitors & Agonists