Boc-L-Lys (N3) -OH - CAS 846549-33-5

Boc-L-Lys (N3) -OH is a click chemistry reagent containing an azido group. Click chemistry holds vast potential for enabling the conjugation of nucleic acids, lipids, proteins, and other molecules. Its widespread application across numerous research areas is attributed to beneficial features such as high yield, high specificity, and simplicity.

ADC Linker

Antibody-drug Conjugate/ADC Related

846549-33-5

C11H20N4O4

272.3

[C@H](NC(OC(C)(C)C)=O)(CCCCN=[N+]=[N-])C(O)=O

-20°C

Ice Packs

Small Compound