BODIPY Isothiocyanate - CAS 1349031-04-4

BODIPY Isothiocyanate exhibits the characteristic fluorescent properties of BODIPY compounds, typically with a high fluorescence quantum yield and specific absorption and emission wavelengths. These fluorescence qualities offer potential applications in fields like bioimaging and chemical analysis. In biological applications, it can serve as a fluorescent probe that reacts with specific groups (such as amino groups) in biomolecules, enabling the labeling and tracking of these molecules. For instance, in cell imaging, it can specifically label certain structures or biological processes within cells for observation and study using fluorescence microscopy and similar tools.

1349031-04-4

C20H18BBrFN3S

442.16

Br[B-]1([N+]2=C(C)C=C(C)C2=C(C3=C(C)C=C(C)N31)C4=CC=C(C=C4)N=C=S)F

-20°C

Ice Packs

Dye-Reagents