C-di-AMP disodium - CAS 2734909-87-4

Cyclic diadenylate (c-di-AMP) sodium functions as a STING agonist by binding to the STING transmembrane protein, thus activating the TBK3-IRF3 signaling pathway. This activation prompts the production of type I IFN and TNF. Additionally, c-di-AMP sodium serves as a bacterial second messenger in Gram-positive bacteria, where it plays crucial roles in regulating cell growth, survival, and virulence, as well as the host immune response. It also acts as a potent mucosal adjuvant by stimulating both humoral and cellular responses [1] [2] [3] [4].

Others, Endogenous Metabolite, STING, Antibacterial

Microbiology/Virology, Metabolism, Others, Immunology/Inflammation

2734818

C20H22N10Na2O12P2

702.38

[Na+].[Na+].[H][C@@]12COP([O-])(=O)O[C@@]3([H])[C@@H](O)[C@@H](O[C@]3([H])COP([O-])(=O)O[C@@]1([H])[C@@H](O)[C@@H](O2)n1cnc2c(N)ncnc12)n1cnc2c(N)ncnc12

-20°C

Ice Packs

Small Compound