Carboxy-PTIO - CAS 145757-47-7

Carboxy-PTIO is a highly effective nitric oxide (NO) scavenger known for its rapid reaction rate with NO, resulting in the formation of nitric dioxide (NO2) . Its direct scavenging action against NO plays a crucial role in preventing hypotension and endotoxic shock, particularly in lipopolysaccharide-stimulated rat models.

Others, NO Synthase

Immunology/Inflammation, Others

145703

C14H17N2O4

277.3

CC1(C)N([O])C(c2ccc(cc2)C(O)=O)=N(=O)C1(C)C |^1:4|

-20°C

Ice Packs

Small Compound