CB2R agonist 4 - CAS 182496-82-8

CB2R agonist 4 is a cannabinoid receptor 2 (CB2R) agonist with an EC50 value of 6.9 μM. It can induce apoptosis, promote reactive oxygen species (ROS) production, and cause protein misfolding. Additionally, CB2R agonist 4 exhibits cytotoxicity against various tumor cells and is applicable for cancer research.

ROS, Cannabinoid Receptor, Apoptosis

Apoptosis, GPCR/G Protein, Immunology/Inflammation

182406

C21H22N2O4

366.41

[C@@H](C(OCC1=CC=CC=C1)=O)(CC(C)C)N2C(=O)C=3C(NC2=O)=CC=CC3

-20°C

Ice Packs

Small Compound