Chlorotris (triphenylphosphine) copper - CAS 15709-76-9

Chlorotris (triphenylphosphine) copper (CuCl (TPP) 3) is a metal complex that targets DNA. Through non-covalent interactions of its copper (I) center, such as groove-binding, it affects DNA function and exhibits inhibitory activity against bacteria, fungi, and tumor cells. Chlorotris (triphenylphosphine) copper holds potential for research as an antimicrobial, antitumor, and antioxidant agent.

Antifungal, Autophagy, Antibacterial

Microbiology/Virology, Autophagy

15624

C54H45ClCuP3

885.86

[Cl-][Cu+]([P](C=1C=CC=CC1)(C=2C=CC=CC2)C=3C=CC=CC3)([P](C=4C=CC=CC4)(C=5C=CC=CC5)C=6C=CC=CC6)[P](C=7C=CC=CC7)(C=8C=CC=CC8)C=9C=CC=CC9

-20°C

Ice Packs

Small Compound