Cholesteryl elaidate - CAS 19485-76-8

Cholesteryl elaidate is an organic compound classified as an ester. It is formed through a reaction between cholesterol and elaidic acid, resulting in a white crystalline solid with a mild sweet taste. In the pharmaceutical industry, cholesteryl elaidate has numerous applications, particularly as a bioactive compound with potential research roles for addressing various medical conditions such as high cholesterol and inflammation-related diseases. Additionally, it has potential use as a food additive to enhance texture and stability.

19485-76-8

C45H78O2

651.1

CCCCCCCC/C=C/CCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1

-20°C

Ice Packs

Inhibitors & Agonists