CPTH6 hydrobromide - CAS 2321332-57-2

CPTH6, a thiazole derivative, selectively inhibits the lysine acetyltransferase activity of Gcn5 and pCAF without affecting p300 or CBP. It effectively blocks the acetylation of H3/H4 histones and α-tubulin in various leukemia cell lines, leading to reduced cell viability by arresting the cell cycle in the G0/G1 phase and inducing apoptosis. Additionally, CPTH6 disrupts autophagy across several tumor cell lines, primarily by interfering with ATG7-mediated autophagosomal membrane elongation.

Others, Apoptosis

Apoptosis, Others

2321332-57-2

C15H16ClN3S?HBr

386.7

N(N=C1CC(C)CC1)C2=NC(=CS2)C3=CC=C(Cl)C=C3.Br

-20°C

Ice Packs

Small Compound