Curdlan - CAS 54724-00-4

Curdlan, a polysaccharide produced by bacteria (Alcaligenes faecalis, now known as Agrobacterium biovar 1), consists of β- (1,3) -linked glucose units, has the ability to form thermoreversible gels, and is utilized in various food and industrial applications due to its unique gelling properties and stability.

Others, ROS, TLR, Antibacterial, NO Synthase

Others, Immunology/Inflammation, Microbiology/Virology

54724-00-4

0.9953

N.COC1[C@@H](O)[C@H](C)O[C@H](CO)[C@H]1O

-20°C

Ice Packs

Small Compound