D-Galactal - CAS 21193-75-9

D-Galactal is a monosaccharide in the carbohydrate class. As an aldohexose, it contains six carbon atoms and an aldehyde functional group. Naturally found in foods such as dairy products, meats, and fruits, D-Galactal can also be synthesized through chemical or enzymatic methods. It has various uses in the food industry, particularly as a flavoring and sweetening agent. Additionally, D-Galactal holds potential for research in metabolic disorders, cancer, and inflammation.

21193-75-9

C6H10O4

146.1412

O[C@@H]1C=CO[C@H](CO)[C@@H]1O

-20°C

Ice Packs

Inhibitors & Agonists