D-Glucal - CAS 13265-84-4

D-Glucal is an organic compound belonging to the family of aldohexoses, which are monosaccharides containing an aldehyde functional group. It features a six-carbon structure and is derived from glucose by oxidizing the primary alcohol group at carbon 1 to an aldehyde group. D-Glucal appears as a white crystalline solid, soluble in water, and has a sweet taste. It serves as a crucial intermediate in the chemical synthesis of various compounds, including pharmaceuticals, agrochemicals, and natural products. D-Glucal can be converted into other carbohydrate derivatives, such as glycosides, glycoconjugates, and amino sugars. Additionally, it plays a role in carbohydrate chemistry research and is used as a chiral component for synthesizing complex structures.

13265-84-4

C6H10O4

146.1412

C(O)[C@@H]1[C@@H](O)[C@H](O)C=CO1

-20°C

Ice Packs

Inhibitors & Agonists