D-Glucaric acid potassium - CAS 576-42-1

D-Glucaric acid potassium (D-Saccharic acid potassium salt) is a compound formed from oxidizing sugars, which can be used to test for the presence of hepatic enzyme induction. Studies indicate that D-glucuronolactone dehydrogenase oxidizes D-Saccharic acid potassium salt into D-glucaro-l,4;6,3-dilactone. Alternate studies suggest that D-Saccharic acid potassium salt forms a complex with Cu (II) and H2O2to decolorize azo, acridine, triphenyl methane, anthraquinone and thiazine-based dyes.

Endogenous Metabolite, Apoptosis

Apoptosis, Metabolism

533

0.9992

C6H9KO8

248.23

[K+].O[C@H]([C@@H](O)[C@@H](O)C([O-])=O)[C@H](O)C(O)=O

-20°C

Ice Packs

Natural Product