DACN (Tos, Suc-OH) - CAS 2109751-68-8

DACN (Tos, Suc-OH) is a click chemistry reagent featuring a cycloalkyne group. The cycloalkyne unit exhibits a uniquely curved structure and high reactivity towards cycloaddition reactions. Employing cycloalkynes, the strain-promoted azide-alkyne cycloaddition (SPAAC) process has been effectively used for reliable molecular conjugation across various fields. Nitrogen serves as a linkage point for diverse functional units in this context. Additionally, DACN demonstrates considerable click-reactivity, along with enhanced thermal and chemical stability.

ADC Linker

Antibody-drug Conjugate/ADC Related

2109751-68-8

C18H22N2O5S

378.44

O=C(O)CCC(=O)N1CC#CCN(CCC1)S(=O)(=O)C2=CC=C(C=C2)C

-20°C

Ice Packs

Small Compound