DBCO-PEG24-acid - CAS 2765066-36-0

DBCO-PEG24-acid is a click chemistry reagent that serves as an analog of DBCO-acid featuring a PEG linker and a DBCO group. The DBCO group is typically utilized in copper-free click chemistry reactions due to its strain-promoted high energy. The hydrophilic polyethylene glycol (PEG) chain enhances water solubility. The terminal carboxylic acid group reacts with primary amine groups in the presence of activators (such as EDC or HATU), forming stable amide bonds. This compound is of reagent grade and strictly for research purposes.

ADC Linker

Antibody-drug Conjugate/ADC Related

2765066-36-0

C70H116N2O28

1433.67

O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCC(=O)N1C=2C=CC=CC2C#CC=3C=CC=CC3C1

-20°C

Ice Packs

Small Compound