Dextrallorphan - CAS 5822-43-5

Dextrallorphan (DXA) is an chemical of the morphinan class that is used in scientific research. It acts as a σ1 receptor agonist and NMDA receptor antagonist. It has no significant affinity for the σ2, μ-opioid, or δ-opioid receptor, or for the serotonin or norepinephrine transporter. As an NMDA receptor antagonist, in vivo, it is approximately twice as potent as dextromethorphan, and five-fold less potent than dextrorphan. Dextrallorphan was found to have a half maximal inhibitory concentration (IC50) for binding to the pituitary and brain receptor of 10,000 ± 1000 nM and 10,000 ± 1500 nM, respectively. While its stereoisomer, levallorphan, had a 10,000 times more potent dose, thus proving that binding to these receptors is stereospecific.

Others

Others

5774

C19H25NO

283.41

C(C=C)N1[C@@]2([C@@]3([C@@](C=4C(C2)=CC=C(O)C4)(CC1)CCCC3)[H])[H]

-20°C

Ice Packs

Small Compound