DHICA - CAS 4790-08-3

DHICA (5,6-Dihydroxyindole-2-carboxylic acid) is an intermediate in melanin synthesis and a component of eumelanin, as well as acting as a moderate potency agonist of GPR35. In the U2OS cell line, DHICA demonstrates the ability to induce β-arrestin translocation signaling with an EC50 value of 23.2 μM. Additionally, it plays a significant role in promoting and protecting against DNA damage.

Endogenous Metabolite, DUB, Arrestin, GPCR, PARP

Chromatin/Epigenetic, Cell Cycle/Checkpoint, Endocrinology/Hormones, DNA Damage/DNA Repair, GPCR/G Protein, Metabolism, Ubiquitination

4790-08-3

C9H7NO4

193.16

O=C(O)C1=CC=2C=C(O)C(O)=CC2N1

-20°C

Ice Packs

Small Compound