Diheptyl phthalate - CAS 3648-21-3

Diheptyl phthalate belongs to the class of phthalate esters and consists of two heptyl (C7) chains attached to the main phthalate backbone. This compound is commonly used as a plasticizer in various polymer materials, such as PVC, to enhance flexibility and durability. It also serves as a lubricant, solvent, or additive in diverse industrial applications, including coatings, adhesives, and sealants. However, Diheptyl phthalate is identified as an environmental pollutant and health hazard due to its potential endocrine disruption and toxicity.

3648-21-3

C22H34O4

362.503

O=C(OCCCCCCC)C1=CC=CC=C1C(OCCCCCCC)=O

-20°C

Ice Packs

Inhibitors & Agonists