Econazole-d6 - CAS 2469273-40-1

Econazole-d6 ((±) -Econazol-d6) is a deuterium-labeled form of Econazole. Econazole ((±) -Econazol) is an orally active imidazole antifungal agent that also acts as a cytochrome P-450 inhibitor and a blocker of calcium and manganese ion uptake. It is effective against various fungi and some Gram-positive bacteria but shows no significant activity against Gram-negative bacteria. Additionally, Econazole can inhibit prostaglandin synthesis and may induce liver damage.

Others, Antifungal, Calcium Channel, Cytochromes P450, Antibacterial

Others, Membrane transporter/Ion channel, Microbiology/Virology, Metabolism

2469232

C18H15Cl3N2O

387.72

C(CN1C=CN=C1)(OC(C2=C(C(=C(Cl)C(=C2[2H])[2H])[2H])[2H])([2H])[2H])C3=C(Cl)C=C(Cl)C=C3

-20°C

Ice Packs

Isotope products