EGFR-IN-97 - CAS 3020681-05-1

EGFR-IN-97 (compound 6q), an EGFR inhibitor, demonstrates effectiveness in inhibiting Ba/F3-EGFR L858R/T790M/C797S and Ba/F3-EGFR Del19/T790M/C797S cells, exhibiting IC 50 values of 0.42 μM and 0.41 μM, respectively. Additionally, at a concentration of 0.8 μM, EGFR-IN-97 is capable of inducing apoptosis in NCI-H1975-EGFR L858R/T790M/C797S cells [1].

EGFR, Apoptosis

Apoptosis, JAK/STAT signaling, Tyrosine Kinase/Adaptors, Angiogenesis

3020681-05-1

C37H36N8O2

624.73

[C@@H](C(NC1=CC=C(NC2=NC(N)=NC=C2)C=C1)=O)(N3CC=4C(C3=O)=CC=C(C4)C5=CC=C(C=C5)N6CCN(C)CC6)C7=CC=CC=C7

-20°C

Ice Packs

Small Compound