EpoY - CAS 245660-13-3

EpoY (SD-142) is an irreversible inhibitor of the primary brain microtubule-associated tyrosine carboxypeptidase (TCP), a complex formed by vasohibin-1 (VASH1) and small vasohibin-binding protein (SVBP) . By inhibiting TCP with an IC50 value of approximately 500 nM, EpoY effectively reduces the levels of detyrosinated α-tubulin, which is crucial for microtubule dynamics and neuronal differentiation. This inhibition results in significant differentiation defects and is linked to potential issues related to cancer and cardiomyopathy.

Others, Endogenous Metabolite

Metabolism, Others

245644

C15H17NO7

323.3

C(N[C@@H](CC1=CC=C(O)C=C1)C(O)=O)(=O)[C@@H]2[C@@H](C(OCC)=O)O2

-20°C

Ice Packs

Small Compound