Eriocalyxin B - CAS 84745-95-9

Eriocalyxin B induces apoptosis and cell cycle arrest in pancreatic adenocarcinoma cells through caspase- and p53-dependent pathways, should be considered a candidate for pancreatic cancer treatment; it is a specific inhibitor of STAT3, it directly targets STAT3 through a covalent linkage to inhibit the phosphorylation and activation of STAT3 and induces apoptosis of STAT3-dependent tumor cells.

FABP, mTOR, STAT, Autophagy, NF-κB, Akt, Apoptosis, cAMP, ROS, PPAR, CDK

Immunology/Inflammation, GPCR/G Protein, PI3K/Akt/mTOR signaling, NF-κB, Cell Cycle/Checkpoint, Metabolism, JAK/STAT signaling, Stem Cells, Autophagy, Apoptosis, Cytoskeletal Signaling, DNA Damage/DNA Repair

84641

0.9984

C20H24O5

344.4

[H][C@@]12C[C@@]3(C(=O)C1=C)[C@@]([H])(CC2)[C@@]12CO[C@]3(O)[C@@H](O)[C@]1([H])C(C)(C)C=CC2=O

-20°C

Ice Packs

Natural Product