Estriol-d3 - CAS 79037-36-8

Estriol-d3 is a deuterated compound of Estriol. Estriol has a CAS number of 50-27-1. Estriol is a hydroxylated metabolite of ESTRADIOL or ESTRONE that has a hydroxyl group at C3, 16-alpha, and 17-beta position. Estriol is a major urinary estrogen. During PREGNANCY, a large amount of estriol is produced by the PLACENTA.

Endogenous Metabolite, Estrogen Receptor/ERR

Metabolism, Endocrinology/Hormones

79037-36-8

C18H21D3O3

291.4

[2H]C1C(O)=C([2H])C2CC[C@@]3([H])[C@]4([H])C[C@@H](O)[C@@](O)([2H])[C@@]4(C)CC[C@]3([H])C=2C=1

-20°C

Ice Packs

Isotope products