Ethacrynic acid D5 - CAS 1330052-59-9

Ethacrynic acid, a diuretic, functions as an inhibitor of L-type voltage-dependent and store-operated calcium channels, facilitating the relaxation of airway smooth muscle (ASM) cells. It exhibits anti-inflammatory effects, notably reducing retinoid-induced ear edema in mice, and inhibits glutathione S-transferases (GSTs), making it a potent suppressor of the NF-kB signaling pathway. Additionally, ethacrynic acid modulates leukotriene formation. A variant, Ethacrynic acid D5, is distinguished by its deuterium labeling.

Calcium Channel, NF-κB, GST

Membrane transporter/Ion channel, NF-κB, Metabolism, Oxidation-Reduction

1329984

C13H12Cl2O4

308.17

C(C(C(C([2H])([2H])[2H])([2H])[2H])=C)(=O)C1=C(Cl)C(Cl)=C(OCC(O)=O)C=C1

-20°C

Ice Packs

Isotope products