Finafloxacin - CAS 209342-40-5

Finafloxacin, a fluoroquinolone antimicrobial agent from a new 8-cyano subclass, is most effective in slightly acidic environments (pH 5.0-6.0), a condition where other fluoroquinolones typically reduce in activity. It selectively targets bacterial type II topoisomerases, such as DNA gyrase and DNA topoisomerase IV, making it suitable for treating serious bacterial infections particularly in acidic contexts, including urinary tract infections (UTIs) and Helicobacter pylori infections.

Others, Antibiotic, Antibacterial

Others, Microbiology/Virology

209297

C20H19FN4O4

398.39

[H][C@]12CN(C[C@]1([H])OCCN2)c1c(F)cc2c(c1C#N)n(cc(C(O)=O)c2=O)C1CC1

-20°C

Ice Packs

Small Compound