Flavokawain 1i - CAS 1098176-51-2

Flavokawain 1i, a derivative of chalcones flavokawain A, flavokawain B, and flavokawain C, exhibits anticancer and antiviral properties. At a concentration of 30 μM, it suppresses the growth of gefitinib-resistant H1975 non-small cell lung cancer (NSCLC) cells by 36% and modulates the protein expression by reducing the levels of heat shock protein 90 (Hsp90) client proteins, including EGFR, c-Met, HER2, Akt, and cyclin-dependent kinase 4 (Cdk4), while increasing the levels of Hsp70, indicative of Hsp90 inhibition. Additionally, intramuscular injection of flavokawain 1i lowers viral loads in pigs afflicted with porcine reproductive and respiratory syndrome virus (PRRSV) .

Others, HSP

Others, Cytoskeletal Signaling, Metabolism

1098176-51-2

C21H18O4

334.37

COC1=C(C(O)=CC(OC)=C1)C(/C=C/C2=C3C(C=CC=C3)=CC=C2)=O

-20°C

Ice Packs

Small Compound