Fmoc-L-Lys (4-N3-Z) -OH - CAS 1446511-14-3

Fmoc-L-Lys (4-N3-Z) -OH is a chemical reagent characterized by its azide group. This compound serves as a lysine building block in solid-phase peptide synthesis (SPPS) with azide functionality, useful as a bioorthogonal handle, an infrared probe, and a photoaffinity label. It undergoes strain-promoted 1,3-dipolar cycloaddition facilitated by trans-cyclooctene decarboxylation. Additionally, Fmoc-L-Lys (4-N3-Z) -OH functions as a click chemistry reagent, enabling copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules containing alkyne groups. Moreover, it can participate in strain-promoted alkyne-azide cycloaddition reactions (SPAAC) with molecules that possess DBCO or BCN groups.

ADC Linker

Antibody-drug Conjugate/ADC Related

1446511-14-3

C29H29N5O6

543.57

C(OC(N[C@@H](CCCCNC(OCC1=CC=C(N=[N+]=[N-])C=C1)=O)C(O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

-20°C

Ice Packs

Small Compound