GJ103 sodium salt - CAS 1459687-96-7

GJ103 sodium salt is an active analog of GJ072, a read-through compound. It has been shown to reduce the surface tension of aqueous solutions, which makes it easier for molecules to move through the solution. It has also been shown to reduce the viscosity of aqueous solutions, which makes it easier for molecules to move through the solution. Additionally, it has been shown to reduce the pH of aqueous solutions, which can have a variety of effects on the biochemical and physiological processes of living organisms.

Others, DNA/RNA Synthesis, ATM/ATR

DNA Damage/DNA Repair, PI3K/Akt/mTOR signaling, Cell Cycle/Checkpoint, Others

1459584

0.9991

C16H13N4NaO3S

364.36

[Na+].COc1cccc(c1)-n1c(SCC([O-])=O)nnc1-c1ccccn1

-20°C

Ice Packs

Small Compound