Glaucocalyxin A - CAS 79498-31-0

1. Glaucocalyxin A (Leukamenin F) -SBE-β-CD could be useful with a better solubility and sustained function in drug delivery. 2. Glaucocalyxin A activates caspase-3, decreases BAD phosphorylation, and reduces the expression of X-linked inhibitor of apoptosis protein. 3. Glaucocalyxin A inhibits Akt phosphorylation, suppresses proliferation, and promotes apoptosis in a dose-dependent manner, but not in normal glial cells. 4. Glaucocalyxin A inhibits collagen-stimulated tyrosine phosphorylation of Syk, LAT, and phospholipase Cγ2, the signaling events in collagen receptor GPVI pathway. 5. Glaucocalyxin A could potentially be developed as an antiplatelet and antithrombotic agent, can inhibit platelet p-selectin secretion and integrin activation by convulxin, is a GPVI selective ligand.

Apoptosis, Akt, Caspase, PI3K

Apoptosis, Proteases/Proteasome, Cytoskeletal Signaling, PI3K/Akt/mTOR signaling

79467

0.998

C20H28O4

332.43

[H][C@@]12CC[C@@H]3[C@@H](O)[C@@]1([C@H](O)C[C@]1([H])C(C)(C)C(=O)CC[C@@]21C)C(=O)C3=C

-20°C

Ice Packs

Natural Product