HI5 - CAS 2411548-90-6

HI5, a potent inhibitor of tubulin and indoleamine 2,3-dioxygenase (IDO), exhibits an inhibitory concentration (IC50) of 70 nM in HeLa cells. It suppresses IDO expression, reduces kynurenine production, and enhances T cell activation and proliferation. Additionally, HI5 impedes tubulin polymerization and cell migration, induces G2/M phase arrest, and leads to apoptosis through the mitochondrial-dependent apoptosis pathway while generating reactive oxidative stress in HeLa cells, making it a valuable compound for anticancer research.

Others, Microtubule Associated, IDO, Apoptosis, Indoleamine 2,3-Dioxygenase (IDO)

Metabolism, Apoptosis, Cytoskeletal Signaling, Others

2411452

C42H43N5O8

745.82

C(C(C(OCCC1=CN(CC2=CC(C(OC3=C(OC)C=CC(/C=C\C4=CC(OC)=C(OC)C(OC)=C4)=C3)=O)=CC=C2)N=N1)=O)N)C=5C=6C(N(C)C5)=CC=CC6

-20°C

Ice Packs

Small Compound