Iturin A - CAS 52229-90-0

Iturin A is a chemical compound with potent antifungal properties against pathogenic yeast and fungi. It interacts with the cytoplasmic membrane of the target cell, leading to the formation of ion conducting pores.

Apoptosis, Others, Reactive Oxygen Species, Autophagy, Antifungal

NF-κB, Others, Autophagy, Immunology/Inflammation, Apoptosis, Metabolism, Microbiology/Virology

52139

[R]CCCCCCCC[C@@H]1CC(N[C@@H](CC(N)=O)C(N[C@H](CC2=CC=C(O)C=C2)C(N[C@H](CC(N)=O)C(N[C@@H](CCC(N)=O)C(N3CCC[C@H]3C(N[C@H](CC(N)=O)C(N[C@@H](CO)C(N1)=O)=O)=O)=O)=O)=O)=O)=O

-20°C

Ice Packs

Natural Product