Kanglexin - CAS 2228847-12-7

Kanglexin is an orally active novel anthraquinone compound. It inhibits NLRP3 inflammasome activation and pyroptosis, offering cardioprotective benefits. By stimulating the FGFR1/ERK signaling pathway, Kanglexin promotes angiogenesis and accelerates wound healing in diabetes. Additionally, it has lipid-lowering effects and inhibits vascular smooth muscle cell dedifferentiation, making it a potential compound for studying hyperlipidemia, fatty liver, and atherosclerosis.

FGFR, Pyroptosis, AMPK, NOD-like Receptor (NLR), ERK

PI3K/Akt/mTOR signaling, Tyrosine Kinase/Adaptors, Immunology/Inflammation, Apoptosis, MAPK, Angiogenesis, Chromatin/Epigenetic

2228828

C21H18O8

398.36

O=C1C=2C=C(OC(=O)CCC(=O)OCC)C=C(O)C2C(=O)C3=C(O)C=C(C=C13)C

-20°C

Ice Packs

Small Compound