KZR-261 - CAS 2376747-46-3

KZR-261 is a Sec61 inhibitor that directly binds to the Sec61 channel, effectively impeding the synthesis of certain Sec61 client proteins. It exhibits broad anti-tumor activity, particularly against colorectal, pancreatic, and prostate cancers, activating the endoplasmic reticulum stress response while showing minimal adverse effects on normal cells. KZR-261 significantly induces apoptosis in H929 cells and effectively suppresses tumor growth in various xenograft mouse models, demonstrating good tolerability.

Others, Caspase, Apoptosis

Others, Proteases/Proteasome, Apoptosis

2376698

C38H61FN6O5S2

765.06

C[C@H]1N([C@H](C)CN(S(=O)(=O)N2C[C@@H](C)CN(S(=O)(=O)C3=CC=C(N(C)C)C=C3)CCCN(CC4CCCCC4)CCC2)C1)C5=CC(OC)=CC(F)=C5

-20°C

Ice Packs

Small Compound