L-Leucyl-4-nitroanilide hydrochloride - CAS 16010-98-3

L-Leucyl-4-nitroanilide hydrochloride is a substrate commonly employed in various biochemical assays for assessing the activity of enzymes such as proteases that cleave peptide bonds. With its unique chemical properties, L-Leucine p-nitroanilide hydrochloride can be cleaved by these enzymes to produce a yellow product known as p-nitroaniline. This characteristic makes it a valuable tool for detecting and quantifying protease activity in biological samples such as blood or tissue extracts.

16010-98-3

C12H18ClN3O3

287.74

N(C([C@H](CC(C)C)N)=O)C1=CC=C(N(=O)=O)C=C1.Cl

-20°C

Ice Packs

Inhibitors & Agonists